C17H24ClNO2 — CID 124950946
2-[(3S)-3-[(3-chlorophenyl)methyl]-2-oxa-8-azaspiro[4.5]decan-8-yl]ethanol (PubChem CID 124950946) has the molecular formula C17H24ClNO2 and a molecular weight of 309.84 g/mol. Its IUPAC name is 2-[(3S)-3-[(3-chlorophenyl)methyl]-2-oxa-8-azaspiro[4.5]decan-8-yl]ethanol.
| Compound Name | 2-[(3S)-3-[(3-chlorophenyl)methyl]-2-oxa-8-azaspiro[4.5]decan-8-yl]ethanol |
|---|---|
| PubChem CID | 124950946 |
| Molecular Formula | C17H24ClNO2 |
| Molecular Weight | 309.84 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 2-[(3S)-3-[(3-chlorophenyl)methyl]-2-oxa-8-azaspiro[4.5]decan-8-yl]ethanol |
| SMILES | OCCN1CCC2(CC1)CO[C@@H](Cc1cccc(Cl)c1)C2 |
| InChI | InChI=1S/C17H24ClNO2/c18-15-3-1-2-14(10-15)11-16-12-17(13-21-16)4-6-19(7-5-17)8-9-20/h1-3,10,16,20H,4-9,11-13H2/t16-/m0/s1 |
| InChIKey | DEVUTJUPDFSIAN-INIZCTEOSA-N |
| XLogP | 2.75 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.84 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |