C28H28N4O — CID 124985921
[(3R)-3-(6-benzyl-2-pyridinyl)piperidin-1-yl]-[2-(pyrazol-1-ylmethyl)phenyl]methanone (PubChem CID 124985921) has the molecular formula C28H28N4O and a molecular weight of 436.56 g/mol. Its IUPAC name is [(3R)-3-(6-benzyl-2-pyridinyl)piperidin-1-yl]-[2-(pyrazol-1-ylmethyl)phenyl]methanone.
| Compound Name | [(3R)-3-(6-benzyl-2-pyridinyl)piperidin-1-yl]-[2-(pyrazol-1-ylmethyl)phenyl]methanone |
|---|---|
| PubChem CID | 124985921 |
| Molecular Formula | C28H28N4O |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | [(3R)-3-(6-benzyl-2-pyridinyl)piperidin-1-yl]-[2-(pyrazol-1-ylmethyl)phenyl]methanone |
| SMILES | O=C(c1ccccc1Cn1cccn1)N1CCC[C@@H](c2cccc(Cc3ccccc3)n2)C1 |
| InChI | InChI=1S/C28H28N4O/c33-28(26-14-5-4-11-23(26)21-32-18-8-16-29-32)31-17-7-12-24(20-31)27-15-6-13-25(30-27)19-22-9-2-1-3-10-22/h1-6,8-11,13-16,18,24H,7,12,17,19-21H2/t24-/m1/s1 |
| InChIKey | NUZPHHGLDKETRJ-XMMPIXPASA-N |
| XLogP | 4.94 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |