C25H23FN4O — CID 1249885
3-(3-fluorophenyl)imino-1-[(4-phenylpiperazin-1-yl)methyl]indol-2-one (PubChem CID 1249885) has the molecular formula C25H23FN4O and a molecular weight of 414.48 g/mol. Its IUPAC name is 3-(3-fluorophenyl)imino-1-[(4-phenylpiperazin-1-yl)methyl]indol-2-one.
| Compound Name | 3-(3-fluorophenyl)imino-1-[(4-phenylpiperazin-1-yl)methyl]indol-2-one |
|---|---|
| PubChem CID | 1249885 |
| Molecular Formula | C25H23FN4O |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 3-(3-fluorophenyl)imino-1-[(4-phenylpiperazin-1-yl)methyl]indol-2-one |
| SMILES | O=C1/C(=N\c2cccc(F)c2)c2ccccc2N1CN1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C25H23FN4O/c26-19-7-6-8-20(17-19)27-24-22-11-4-5-12-23(22)30(25(24)31)18-28-13-15-29(16-14-28)21-9-2-1-3-10-21/h1-12,17H,13-16,18H2/b27-24- |
| InChIKey | AXJIVBDTOCJGRI-PNHLSOANSA-N |
| XLogP | 4.07 |
| TPSA | 39.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|