C25H20F3N3O — CID 1043389
1-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-3-[3-(trifluoromethyl)phenyl]iminoindol-2-one (PubChem CID 1043389) has the molecular formula C25H20F3N3O and a molecular weight of 435.45 g/mol. Its IUPAC name is 1-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-3-[3-(trifluoromethyl)phenyl]iminoindol-2-one.
| Compound Name | 1-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-3-[3-(trifluoromethyl)phenyl]iminoindol-2-one |
|---|---|
| PubChem CID | 1043389 |
| Molecular Formula | C25H20F3N3O |
| Molecular Weight | 435.45 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | 1-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-3-[3-(trifluoromethyl)phenyl]iminoindol-2-one |
| SMILES | O=C1/C(=N/c2cccc(C(F)(F)F)c2)c2ccccc2N1CN1CCc2ccccc2C1 |
| InChI | InChI=1S/C25H20F3N3O/c26-25(27,28)19-8-5-9-20(14-19)29-23-21-10-3-4-11-22(21)31(24(23)32)16-30-13-12-17-6-1-2-7-18(17)15-30/h1-11,14H,12-13,15-16H2/b29-23+ |
| InChIKey | WIKKNMOJGPBWRW-BYNJWEBRSA-N |
| XLogP | 5.19 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.45 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|