C21H23N3O2 — CID 3556162
3-(3,4-dimethylphenyl)imino-1-(morpholin-4-ylmethyl)indol-2-one (PubChem CID 3556162) has the molecular formula C21H23N3O2 and a molecular weight of 349.43 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)imino-1-(morpholin-4-ylmethyl)indol-2-one.
| Compound Name | 3-(3,4-dimethylphenyl)imino-1-(morpholin-4-ylmethyl)indol-2-one |
|---|---|
| PubChem CID | 3556162 |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 3-(3,4-dimethylphenyl)imino-1-(morpholin-4-ylmethyl)indol-2-one |
| SMILES | Cc1ccc(/N=C2\C(=O)N(CN3CCOCC3)c3ccccc32)cc1C |
| InChI | InChI=1S/C21H23N3O2/c1-15-7-8-17(13-16(15)2)22-20-18-5-3-4-6-19(18)24(21(20)25)14-23-9-11-26-12-10-23/h3-8,13H,9-12,14H2,1-2H3/b22-20- |
| InChIKey | JNVHBSWJEJVICB-XDOYNYLZSA-N |
| XLogP | 3.06 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|