C22H24FN3O4S — CID 124991331
(2R)-4-(benzenesulfonyl)-2-[5-[2-(2-fluorophenoxy)ethyl]-1-methylpyrazol-3-yl]morpholine (PubChem CID 124991331) has the molecular formula C22H24FN3O4S and a molecular weight of 445.52 g/mol. Its IUPAC name is (2R)-4-(benzenesulfonyl)-2-[5-[2-(2-fluorophenoxy)ethyl]-1-methylpyrazol-3-yl]morpholine.
| Compound Name | (2R)-4-(benzenesulfonyl)-2-[5-[2-(2-fluorophenoxy)ethyl]-1-methylpyrazol-3-yl]morpholine |
|---|---|
| PubChem CID | 124991331 |
| Molecular Formula | C22H24FN3O4S |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | (2R)-4-(benzenesulfonyl)-2-[5-[2-(2-fluorophenoxy)ethyl]-1-methylpyrazol-3-yl]morpholine |
| SMILES | Cn1nc([C@H]2CN(S(=O)(=O)c3ccccc3)CCO2)cc1CCOc1ccccc1F |
| InChI | InChI=1S/C22H24FN3O4S/c1-25-17(11-13-29-21-10-6-5-9-19(21)23)15-20(24-25)22-16-26(12-14-30-22)31(27,28)18-7-3-2-4-8-18/h2-10,15,22H,11-14,16H2,1H3/t22-/m1/s1 |
| InChIKey | PIJXNLYPOSCEPV-JOCHJYFZSA-N |
| XLogP | 2.94 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |