C13H15N5O4S — CID 124994732
[(3R)-3-(4-methylsulfonyl-1H-pyrazol-5-yl)morpholin-4-yl]-pyrimidin-4-ylmethanone (PubChem CID 124994732) has the molecular formula C13H15N5O4S and a molecular weight of 337.36 g/mol. Its IUPAC name is [(3R)-3-(4-methylsulfonyl-1H-pyrazol-5-yl)morpholin-4-yl]-pyrimidin-4-ylmethanone.
| Compound Name | [(3R)-3-(4-methylsulfonyl-1H-pyrazol-5-yl)morpholin-4-yl]-pyrimidin-4-ylmethanone |
|---|---|
| PubChem CID | 124994732 |
| Molecular Formula | C13H15N5O4S |
| Molecular Weight | 337.36 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | [(3R)-3-(4-methylsulfonyl-1H-pyrazol-5-yl)morpholin-4-yl]-pyrimidin-4-ylmethanone |
| SMILES | CS(=O)(=O)c1cn[nH]c1[C@@H]1COCCN1C(=O)c1ccncn1 |
| InChI | InChI=1S/C13H15N5O4S/c1-23(20,21)11-6-16-17-12(11)10-7-22-5-4-18(10)13(19)9-2-3-14-8-15-9/h2-3,6,8,10H,4-5,7H2,1H3,(H,16,17)/t10-/m0/s1 |
| InChIKey | QGQGYUDXFPOCOD-JTQLQIEISA-N |
| XLogP | -0.18 |
| TPSA | 118.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.36 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |