C15H21N5O2S — CID 124994871
2-(1-ethylpyrazol-4-yl)-5-[(3R)-1-methylsulfonylpiperidin-3-yl]pyrazine (PubChem CID 124994871) has the molecular formula C15H21N5O2S and a molecular weight of 335.43 g/mol. Its IUPAC name is 2-(1-ethylpyrazol-4-yl)-5-[(3R)-1-methylsulfonylpiperidin-3-yl]pyrazine.
| Compound Name | 2-(1-ethylpyrazol-4-yl)-5-[(3R)-1-methylsulfonylpiperidin-3-yl]pyrazine |
|---|---|
| PubChem CID | 124994871 |
| Molecular Formula | C15H21N5O2S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 2-(1-ethylpyrazol-4-yl)-5-[(3R)-1-methylsulfonylpiperidin-3-yl]pyrazine |
| SMILES | CCn1cc(-c2cnc([C@@H]3CCCN(S(C)(=O)=O)C3)cn2)cn1 |
| InChI | InChI=1S/C15H21N5O2S/c1-3-19-10-13(7-18-19)15-9-16-14(8-17-15)12-5-4-6-20(11-12)23(2,21)22/h7-10,12H,3-6,11H2,1-2H3/t12-/m1/s1 |
| InChIKey | QHWDVFSQARXVIN-GFCCVEGCSA-N |
| XLogP | 1.50 |
| TPSA | 80.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |