C13H16N4O3S — CID 124976826
2-[5-[(3R)-1-methylsulfonylpiperidin-3-yl]pyrazin-2-yl]-1,3-oxazole (PubChem CID 124976826) has the molecular formula C13H16N4O3S and a molecular weight of 308.36 g/mol. Its IUPAC name is 2-[5-[(3R)-1-methylsulfonylpiperidin-3-yl]pyrazin-2-yl]-1,3-oxazole.
| Compound Name | 2-[5-[(3R)-1-methylsulfonylpiperidin-3-yl]pyrazin-2-yl]-1,3-oxazole |
|---|---|
| PubChem CID | 124976826 |
| Molecular Formula | C13H16N4O3S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 2-[5-[(3R)-1-methylsulfonylpiperidin-3-yl]pyrazin-2-yl]-1,3-oxazole |
| SMILES | CS(=O)(=O)N1CCC[C@@H](c2cnc(-c3ncco3)cn2)C1 |
| InChI | InChI=1S/C13H16N4O3S/c1-21(18,19)17-5-2-3-10(9-17)11-7-16-12(8-15-11)13-14-4-6-20-13/h4,6-8,10H,2-3,5,9H2,1H3/t10-/m1/s1 |
| InChIKey | LIEYPHKTHGPRQN-SNVBAGLBSA-N |
| XLogP | 1.27 |
| TPSA | 89.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |