C14H17N3O2S2 — CID 124982395
2-[6-[(3S)-1-methylsulfonylpiperidin-3-yl]-3-pyridinyl]-1,3-thiazole (PubChem CID 124982395) has the molecular formula C14H17N3O2S2 and a molecular weight of 323.44 g/mol. Its IUPAC name is 2-[6-[(3S)-1-methylsulfonylpiperidin-3-yl]-3-pyridinyl]-1,3-thiazole.
| Compound Name | 2-[6-[(3S)-1-methylsulfonylpiperidin-3-yl]-3-pyridinyl]-1,3-thiazole |
|---|---|
| PubChem CID | 124982395 |
| Molecular Formula | C14H17N3O2S2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 2-[6-[(3S)-1-methylsulfonylpiperidin-3-yl]-3-pyridinyl]-1,3-thiazole |
| SMILES | CS(=O)(=O)N1CCC[C@H](c2ccc(-c3nccs3)cn2)C1 |
| InChI | InChI=1S/C14H17N3O2S2/c1-21(18,19)17-7-2-3-12(10-17)13-5-4-11(9-16-13)14-15-6-8-20-14/h4-6,8-9,12H,2-3,7,10H2,1H3/t12-/m0/s1 |
| InChIKey | MWQXUEPHSNIIHS-LBPRGKRZSA-N |
| XLogP | 2.34 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |