C13H16N4O2S2 — CID 125012790
5-[6-[(3R)-1-methylsulfonylpiperidin-3-yl]pyrazin-2-yl]-1,3-thiazole (PubChem CID 125012790) has the molecular formula C13H16N4O2S2 and a molecular weight of 324.43 g/mol. Its IUPAC name is 5-[6-[(3R)-1-methylsulfonylpiperidin-3-yl]pyrazin-2-yl]-1,3-thiazole.
| Compound Name | 5-[6-[(3R)-1-methylsulfonylpiperidin-3-yl]pyrazin-2-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 125012790 |
| Molecular Formula | C13H16N4O2S2 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 5-[6-[(3R)-1-methylsulfonylpiperidin-3-yl]pyrazin-2-yl]-1,3-thiazole |
| SMILES | CS(=O)(=O)N1CCC[C@@H](c2cncc(-c3cncs3)n2)C1 |
| InChI | InChI=1S/C13H16N4O2S2/c1-21(18,19)17-4-2-3-10(8-17)11-5-14-6-12(16-11)13-7-15-9-20-13/h5-7,9-10H,2-4,8H2,1H3/t10-/m1/s1 |
| InChIKey | WAJPABJIDJPFQD-SNVBAGLBSA-N |
| XLogP | 1.74 |
| TPSA | 76.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |