C23H26N4O — CID 124996999
6-[(2R)-1-[[2-(2-methoxyphenyl)phenyl]methyl]pyrrolidin-2-yl]-N-methylpyrazin-2-amine (PubChem CID 124996999) has the molecular formula C23H26N4O and a molecular weight of 374.49 g/mol. Its IUPAC name is 6-[(2R)-1-[[2-(2-methoxyphenyl)phenyl]methyl]pyrrolidin-2-yl]-N-methylpyrazin-2-amine.
| Compound Name | 6-[(2R)-1-[[2-(2-methoxyphenyl)phenyl]methyl]pyrrolidin-2-yl]-N-methylpyrazin-2-amine |
|---|---|
| PubChem CID | 124996999 |
| Molecular Formula | C23H26N4O |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | 6-[(2R)-1-[[2-(2-methoxyphenyl)phenyl]methyl]pyrrolidin-2-yl]-N-methylpyrazin-2-amine |
| SMILES | CNc1cncc([C@H]2CCCN2Cc2ccccc2-c2ccccc2OC)n1 |
| InChI | InChI=1S/C23H26N4O/c1-24-23-15-25-14-20(26-23)21-11-7-13-27(21)16-17-8-3-4-9-18(17)19-10-5-6-12-22(19)28-2/h3-6,8-10,12,14-15,21H,7,11,13,16H2,1-2H3,(H,24,26)/t21-/m1/s1 |
| InChIKey | QXDIESUTBMCXKD-OAQYLSRUSA-N |
| XLogP | 4.53 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |