C14H18N4S — CID 132776032
N-methyl-6-[1-(thiophen-2-ylmethyl)pyrrolidin-2-yl]pyrazin-2-amine (PubChem CID 132776032) has the molecular formula C14H18N4S and a molecular weight of 274.39 g/mol. Its IUPAC name is N-methyl-6-[1-(thiophen-2-ylmethyl)pyrrolidin-2-yl]pyrazin-2-amine.
| Compound Name | N-methyl-6-[1-(thiophen-2-ylmethyl)pyrrolidin-2-yl]pyrazin-2-amine |
|---|---|
| PubChem CID | 132776032 |
| Molecular Formula | C14H18N4S |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | N-methyl-6-[1-(thiophen-2-ylmethyl)pyrrolidin-2-yl]pyrazin-2-amine |
| SMILES | CNc1cncc(C2CCCN2Cc2cccs2)n1 |
| InChI | InChI=1S/C14H18N4S/c1-15-14-9-16-8-12(17-14)13-5-2-6-18(13)10-11-4-3-7-19-11/h3-4,7-9,13H,2,5-6,10H2,1H3,(H,15,17) |
| InChIKey | OMAPXGYJMNMKIG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |