C18H20N4S — CID 95815698
2-(2-methylimidazol-1-yl)-6-[(2S)-1-(thiophen-2-ylmethyl)pyrrolidin-2-yl]pyridine (PubChem CID 95815698) has the molecular formula C18H20N4S and a molecular weight of 324.45 g/mol. Its IUPAC name is 2-(2-methylimidazol-1-yl)-6-[(2S)-1-(thiophen-2-ylmethyl)pyrrolidin-2-yl]pyridine.
| Compound Name | 2-(2-methylimidazol-1-yl)-6-[(2S)-1-(thiophen-2-ylmethyl)pyrrolidin-2-yl]pyridine |
|---|---|
| PubChem CID | 95815698 |
| Molecular Formula | C18H20N4S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 2-(2-methylimidazol-1-yl)-6-[(2S)-1-(thiophen-2-ylmethyl)pyrrolidin-2-yl]pyridine |
| SMILES | Cc1nccn1-c1cccc([C@@H]2CCCN2Cc2cccs2)n1 |
| InChI | InChI=1S/C18H20N4S/c1-14-19-9-11-22(14)18-8-2-6-16(20-18)17-7-3-10-21(17)13-15-5-4-12-23-15/h2,4-6,8-9,11-12,17H,3,7,10,13H2,1H3/t17-/m0/s1 |
| InChIKey | BNWAUIWOIKFTPW-KRWDZBQOSA-N |
| XLogP | 3.97 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |