C15H20N4S — CID 124966086
N-methyl-4-[(2R)-1-(thiophen-2-ylmethyl)piperidin-2-yl]pyrimidin-2-amine (PubChem CID 124966086) has the molecular formula C15H20N4S and a molecular weight of 288.42 g/mol. Its IUPAC name is N-methyl-4-[(2R)-1-(thiophen-2-ylmethyl)piperidin-2-yl]pyrimidin-2-amine.
| Compound Name | N-methyl-4-[(2R)-1-(thiophen-2-ylmethyl)piperidin-2-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 124966086 |
| Molecular Formula | C15H20N4S |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | N-methyl-4-[(2R)-1-(thiophen-2-ylmethyl)piperidin-2-yl]pyrimidin-2-amine |
| SMILES | CNc1nccc([C@H]2CCCCN2Cc2cccs2)n1 |
| InChI | InChI=1S/C15H20N4S/c1-16-15-17-8-7-13(18-15)14-6-2-3-9-19(14)11-12-5-4-10-20-12/h4-5,7-8,10,14H,2-3,6,9,11H2,1H3,(H,16,17,18)/t14-/m1/s1 |
| InChIKey | IJLJIMQUBVJEQF-CQSZACIVSA-N |
| XLogP | 3.31 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |