C19H22N4S — CID 95815941
2-(2-ethylimidazol-1-yl)-6-[(2R)-1-(thiophen-3-ylmethyl)pyrrolidin-2-yl]pyridine (PubChem CID 95815941) has the molecular formula C19H22N4S and a molecular weight of 338.48 g/mol. Its IUPAC name is 2-(2-ethylimidazol-1-yl)-6-[(2R)-1-(thiophen-3-ylmethyl)pyrrolidin-2-yl]pyridine.
| Compound Name | 2-(2-ethylimidazol-1-yl)-6-[(2R)-1-(thiophen-3-ylmethyl)pyrrolidin-2-yl]pyridine |
|---|---|
| PubChem CID | 95815941 |
| Molecular Formula | C19H22N4S |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 2-(2-ethylimidazol-1-yl)-6-[(2R)-1-(thiophen-3-ylmethyl)pyrrolidin-2-yl]pyridine |
| SMILES | CCc1nccn1-c1cccc([C@H]2CCCN2Cc2ccsc2)n1 |
| InChI | InChI=1S/C19H22N4S/c1-2-18-20-9-11-23(18)19-7-3-5-16(21-19)17-6-4-10-22(17)13-15-8-12-24-14-15/h3,5,7-9,11-12,14,17H,2,4,6,10,13H2,1H3/t17-/m1/s1 |
| InChIKey | QGPJMLWNUZSLMO-QGZVFWFLSA-N |
| XLogP | 4.23 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |