C13H18ClN3O2 — CID 124997181
tert-butyl (2S)-2-(3-chloropyrazin-2-yl)pyrrolidine-1-carboxylate (PubChem CID 124997181) has the molecular formula C13H18ClN3O2 and a molecular weight of 283.76 g/mol. Its IUPAC name is tert-butyl (2S)-2-(3-chloropyrazin-2-yl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-(3-chloropyrazin-2-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 124997181 |
| Molecular Formula | C13H18ClN3O2 |
| Molecular Weight | 283.76 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | tert-butyl (2S)-2-(3-chloropyrazin-2-yl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1c1nccnc1Cl |
| InChI | InChI=1S/C13H18ClN3O2/c1-13(2,3)19-12(18)17-8-4-5-9(17)10-11(14)16-7-6-15-10/h6-7,9H,4-5,8H2,1-3H3/t9-/m0/s1 |
| InChIKey | QYGHVEFQSOWUDW-VIFPVBQESA-N |
| XLogP | 3.20 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.76 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |