C20H21Cl2N3O3 — CID 125000182
2-[(3S)-3-[(4-chlorophenoxy)methyl]-1-(2-chloropyridine-3-carbonyl)piperidin-3-yl]acetamide (PubChem CID 125000182) has the molecular formula C20H21Cl2N3O3 and a molecular weight of 422.31 g/mol. Its IUPAC name is 2-[(3S)-3-[(4-chlorophenoxy)methyl]-1-(2-chloropyridine-3-carbonyl)piperidin-3-yl]acetamide.
| Compound Name | 2-[(3S)-3-[(4-chlorophenoxy)methyl]-1-(2-chloropyridine-3-carbonyl)piperidin-3-yl]acetamide |
|---|---|
| PubChem CID | 125000182 |
| Molecular Formula | C20H21Cl2N3O3 |
| Molecular Weight | 422.31 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | 2-[(3S)-3-[(4-chlorophenoxy)methyl]-1-(2-chloropyridine-3-carbonyl)piperidin-3-yl]acetamide |
| SMILES | NC(=O)C[C@@]1(COc2ccc(Cl)cc2)CCCN(C(=O)c2cccnc2Cl)C1 |
| InChI | InChI=1S/C20H21Cl2N3O3/c21-14-4-6-15(7-5-14)28-13-20(11-17(23)26)8-2-10-25(12-20)19(27)16-3-1-9-24-18(16)22/h1,3-7,9H,2,8,10-13H2,(H2,23,26)/t20-/m0/s1 |
| InChIKey | RUBOGCBZGFLTBH-FQEVSTJZSA-N |
| XLogP | 3.57 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.31 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|