C25H31ClN4O3 — CID 110081518
2-[1-(2-chloropyridine-3-carbonyl)-3-(phenoxymethyl)piperidin-3-yl]-1-(4-methylpiperazin-1-yl)ethanone (PubChem CID 110081518) has the molecular formula C25H31ClN4O3 and a molecular weight of 471.00 g/mol. Its IUPAC name is 2-[1-(2-chloropyridine-3-carbonyl)-3-(phenoxymethyl)piperidin-3-yl]-1-(4-methylpiperazin-1-yl)ethanone.
| Compound Name | 2-[1-(2-chloropyridine-3-carbonyl)-3-(phenoxymethyl)piperidin-3-yl]-1-(4-methylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 110081518 |
| Molecular Formula | C25H31ClN4O3 |
| Molecular Weight | 471.00 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | 2-[1-(2-chloropyridine-3-carbonyl)-3-(phenoxymethyl)piperidin-3-yl]-1-(4-methylpiperazin-1-yl)ethanone |
| SMILES | CN1CCN(C(=O)CC2(COc3ccccc3)CCCN(C(=O)c3cccnc3Cl)C2)CC1 |
| InChI | InChI=1S/C25H31ClN4O3/c1-28-13-15-29(16-14-28)22(31)17-25(19-33-20-7-3-2-4-8-20)10-6-12-30(18-25)24(32)21-9-5-11-27-23(21)26/h2-5,7-9,11H,6,10,12-19H2,1H3 |
| InChIKey | NCVDZKPLNDZBLN-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 65.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.00 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|