C18H21N3S — CID 125001367
7-[(2R)-1-benzylpiperidin-2-yl]-5-methylimidazo[5,1-b][1,3]thiazole (PubChem CID 125001367) has the molecular formula C18H21N3S and a molecular weight of 311.45 g/mol. Its IUPAC name is 7-[(2R)-1-benzylpiperidin-2-yl]-5-methylimidazo[5,1-b][1,3]thiazole.
| Compound Name | 7-[(2R)-1-benzylpiperidin-2-yl]-5-methylimidazo[5,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 125001367 |
| Molecular Formula | C18H21N3S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 7-[(2R)-1-benzylpiperidin-2-yl]-5-methylimidazo[5,1-b][1,3]thiazole |
| SMILES | Cc1nc([C@H]2CCCCN2Cc2ccccc2)c2sccn12 |
| InChI | InChI=1S/C18H21N3S/c1-14-19-17(18-21(14)11-12-22-18)16-9-5-6-10-20(16)13-15-7-3-2-4-8-15/h2-4,7-8,11-12,16H,5-6,9-10,13H2,1H3/t16-/m1/s1 |
| InChIKey | SCUHFIISFIPKKW-MRXNPFEDSA-N |
| XLogP | 4.43 |
| TPSA | 20.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |