C27H26N2O3 — CID 125003734
(5R)-3-benzyl-7-(2,2-diphenylacetyl)-1-oxa-3,7-diazaspiro[4.4]nonan-2-one (PubChem CID 125003734) has the molecular formula C27H26N2O3 and a molecular weight of 426.52 g/mol. Its IUPAC name is (5R)-3-benzyl-7-(2,2-diphenylacetyl)-1-oxa-3,7-diazaspiro[4.4]nonan-2-one.
| Compound Name | (5R)-3-benzyl-7-(2,2-diphenylacetyl)-1-oxa-3,7-diazaspiro[4.4]nonan-2-one |
|---|---|
| PubChem CID | 125003734 |
| Molecular Formula | C27H26N2O3 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | (5R)-3-benzyl-7-(2,2-diphenylacetyl)-1-oxa-3,7-diazaspiro[4.4]nonan-2-one |
| SMILES | O=C1O[C@@]2(CCN(C(=O)C(c3ccccc3)c3ccccc3)C2)CN1Cc1ccccc1 |
| InChI | InChI=1S/C27H26N2O3/c30-25(24(22-12-6-2-7-13-22)23-14-8-3-9-15-23)28-17-16-27(19-28)20-29(26(31)32-27)18-21-10-4-1-5-11-21/h1-15,24H,16-20H2/t27-/m1/s1 |
| InChIKey | STOPRYOXVAPNML-HHHXNRCGSA-N |
| XLogP | 4.44 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |