C28H28N2O3 — CID 132772541
9-(2,2-diphenylacetyl)-3-phenyl-1-oxa-3,9-diazaspiro[4.6]undecan-2-one (PubChem CID 132772541) has the molecular formula C28H28N2O3 and a molecular weight of 440.54 g/mol. Its IUPAC name is 9-(2,2-diphenylacetyl)-3-phenyl-1-oxa-3,9-diazaspiro[4.6]undecan-2-one.
| Compound Name | 9-(2,2-diphenylacetyl)-3-phenyl-1-oxa-3,9-diazaspiro[4.6]undecan-2-one |
|---|---|
| PubChem CID | 132772541 |
| Molecular Formula | C28H28N2O3 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | 9-(2,2-diphenylacetyl)-3-phenyl-1-oxa-3,9-diazaspiro[4.6]undecan-2-one |
| SMILES | O=C(C(c1ccccc1)c1ccccc1)N1CCCC2(CC1)CN(c1ccccc1)C(=O)O2 |
| InChI | InChI=1S/C28H28N2O3/c31-26(25(22-11-4-1-5-12-22)23-13-6-2-7-14-23)29-19-10-17-28(18-20-29)21-30(27(32)33-28)24-15-8-3-9-16-24/h1-9,11-16,25H,10,17-21H2 |
| InChIKey | VWMBFTVCFXLZLW-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |