C17H25N3O3 — CID 125009841
6-[(3R)-1-[2-(1-hydroxycyclohexyl)acetyl]piperidin-3-yl]-1H-pyrimidin-2-one (PubChem CID 125009841) has the molecular formula C17H25N3O3 and a molecular weight of 319.40 g/mol. Its IUPAC name is 6-[(3R)-1-[2-(1-hydroxycyclohexyl)acetyl]piperidin-3-yl]-1H-pyrimidin-2-one.
| Compound Name | 6-[(3R)-1-[2-(1-hydroxycyclohexyl)acetyl]piperidin-3-yl]-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 125009841 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | 6-[(3R)-1-[2-(1-hydroxycyclohexyl)acetyl]piperidin-3-yl]-1H-pyrimidin-2-one |
| SMILES | O=C(CC1(O)CCCCC1)N1CCC[C@@H](c2ccnc(=O)[nH]2)C1 |
| InChI | InChI=1S/C17H25N3O3/c21-15(11-17(23)7-2-1-3-8-17)20-10-4-5-13(12-20)14-6-9-18-16(22)19-14/h6,9,13,23H,1-5,7-8,10-12H2,(H,18,19,22)/t13-/m1/s1 |
| InChIKey | VFECYGKJYFVDLV-CYBMUJFWSA-N |
| XLogP | 1.56 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |