C18H20N4O3S — CID 125010117
3-[(2R)-4-formyl-1-(4-methyl-1,3-thiazole-5-carbonyl)piperazin-2-yl]-N-methylbenzamide (PubChem CID 125010117) has the molecular formula C18H20N4O3S and a molecular weight of 372.45 g/mol. Its IUPAC name is 3-[(2R)-4-formyl-1-(4-methyl-1,3-thiazole-5-carbonyl)piperazin-2-yl]-N-methylbenzamide.
| Compound Name | 3-[(2R)-4-formyl-1-(4-methyl-1,3-thiazole-5-carbonyl)piperazin-2-yl]-N-methylbenzamide |
|---|---|
| PubChem CID | 125010117 |
| Molecular Formula | C18H20N4O3S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 3-[(2R)-4-formyl-1-(4-methyl-1,3-thiazole-5-carbonyl)piperazin-2-yl]-N-methylbenzamide |
| SMILES | CNC(=O)c1cccc([C@@H]2CN(C=O)CCN2C(=O)c2scnc2C)c1 |
| InChI | InChI=1S/C18H20N4O3S/c1-12-16(26-10-20-12)18(25)22-7-6-21(11-23)9-15(22)13-4-3-5-14(8-13)17(24)19-2/h3-5,8,10-11,15H,6-7,9H2,1-2H3,(H,19,24)/t15-/m0/s1 |
| InChIKey | VHCCUOQKYPVUPG-HNNXBMFYSA-N |
| XLogP | 1.47 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|