C28H29N3O3 — CID 129454780
3-[(2R)-4-acetyl-1-(2,2-diphenylacetyl)piperazin-2-yl]-N-methylbenzamide (PubChem CID 129454780) has the molecular formula C28H29N3O3 and a molecular weight of 455.56 g/mol. Its IUPAC name is 3-[(2R)-4-acetyl-1-(2,2-diphenylacetyl)piperazin-2-yl]-N-methylbenzamide.
| Compound Name | 3-[(2R)-4-acetyl-1-(2,2-diphenylacetyl)piperazin-2-yl]-N-methylbenzamide |
|---|---|
| PubChem CID | 129454780 |
| Molecular Formula | C28H29N3O3 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | 3-[(2R)-4-acetyl-1-(2,2-diphenylacetyl)piperazin-2-yl]-N-methylbenzamide |
| SMILES | CNC(=O)c1cccc([C@@H]2CN(C(C)=O)CCN2C(=O)C(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C28H29N3O3/c1-20(32)30-16-17-31(25(19-30)23-14-9-15-24(18-23)27(33)29-2)28(34)26(21-10-5-3-6-11-21)22-12-7-4-8-13-22/h3-15,18,25-26H,16-17,19H2,1-2H3,(H,29,33)/t25-/m0/s1 |
| InChIKey | GAIWLDHGVAWVGB-VWLOTQADSA-N |
| XLogP | 3.61 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |