C27H33N3O4 — CID 129458626
3-[(2R)-1-acetyl-4-[4-(3-methylphenyl)oxane-4-carbonyl]piperazin-2-yl]-N-methylbenzamide (PubChem CID 129458626) has the molecular formula C27H33N3O4 and a molecular weight of 463.58 g/mol. Its IUPAC name is 3-[(2R)-1-acetyl-4-[4-(3-methylphenyl)oxane-4-carbonyl]piperazin-2-yl]-N-methylbenzamide.
| Compound Name | 3-[(2R)-1-acetyl-4-[4-(3-methylphenyl)oxane-4-carbonyl]piperazin-2-yl]-N-methylbenzamide |
|---|---|
| PubChem CID | 129458626 |
| Molecular Formula | C27H33N3O4 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.25 |
| IUPAC Name | 3-[(2R)-1-acetyl-4-[4-(3-methylphenyl)oxane-4-carbonyl]piperazin-2-yl]-N-methylbenzamide |
| SMILES | CNC(=O)c1cccc([C@@H]2CN(C(=O)C3(c4cccc(C)c4)CCOCC3)CCN2C(C)=O)c1 |
| InChI | InChI=1S/C27H33N3O4/c1-19-6-4-9-23(16-19)27(10-14-34-15-11-27)26(33)29-12-13-30(20(2)31)24(18-29)21-7-5-8-22(17-21)25(32)28-3/h4-9,16-17,24H,10-15,18H2,1-3H3,(H,28,32)/t24-/m0/s1 |
| InChIKey | UNILFVKCGRYEGR-DEOSSOPVSA-N |
| XLogP | 2.83 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |