C16H17ClN4O — CID 125011653
(2R)-1-[(3-chlorophenyl)methyl]-2-pyrazin-2-ylpyrrolidine-2-carboxamide (PubChem CID 125011653) has the molecular formula C16H17ClN4O and a molecular weight of 316.79 g/mol. Its IUPAC name is (2R)-1-[(3-chlorophenyl)methyl]-2-pyrazin-2-ylpyrrolidine-2-carboxamide.
| Compound Name | (2R)-1-[(3-chlorophenyl)methyl]-2-pyrazin-2-ylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 125011653 |
| Molecular Formula | C16H17ClN4O |
| Molecular Weight | 316.79 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | (2R)-1-[(3-chlorophenyl)methyl]-2-pyrazin-2-ylpyrrolidine-2-carboxamide |
| SMILES | NC(=O)[C@]1(c2cnccn2)CCCN1Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C16H17ClN4O/c17-13-4-1-3-12(9-13)11-21-8-2-5-16(21,15(18)22)14-10-19-6-7-20-14/h1,3-4,6-7,9-10H,2,5,8,11H2,(H2,18,22)/t16-/m1/s1 |
| InChIKey | VRVGLDSCKBWJOC-MRXNPFEDSA-N |
| XLogP | 2.11 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.79 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |