C15H16N4O2S — CID 118740026
2-pyrazin-2-yl-1-(2-thiophen-3-ylacetyl)pyrrolidine-2-carboxamide (PubChem CID 118740026) has the molecular formula C15H16N4O2S and a molecular weight of 316.39 g/mol. Its IUPAC name is 2-pyrazin-2-yl-1-(2-thiophen-3-ylacetyl)pyrrolidine-2-carboxamide.
| Compound Name | 2-pyrazin-2-yl-1-(2-thiophen-3-ylacetyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 118740026 |
| Molecular Formula | C15H16N4O2S |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 2-pyrazin-2-yl-1-(2-thiophen-3-ylacetyl)pyrrolidine-2-carboxamide |
| SMILES | NC(=O)C1(c2cnccn2)CCCN1C(=O)Cc1ccsc1 |
| InChI | InChI=1S/C15H16N4O2S/c16-14(21)15(12-9-17-4-5-18-12)3-1-6-19(15)13(20)8-11-2-7-22-10-11/h2,4-5,7,9-10H,1,3,6,8H2,(H2,16,21) |
| InChIKey | DOMARFRXWXVRRL-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |