C18H18N6O — CID 125013420
[(3S)-3-pyrazin-2-ylpiperidin-1-yl]-(6-pyrazol-1-yl-3-pyridinyl)methanone (PubChem CID 125013420) has the molecular formula C18H18N6O and a molecular weight of 334.38 g/mol. Its IUPAC name is [(3S)-3-pyrazin-2-ylpiperidin-1-yl]-(6-pyrazol-1-yl-3-pyridinyl)methanone.
| Compound Name | [(3S)-3-pyrazin-2-ylpiperidin-1-yl]-(6-pyrazol-1-yl-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 125013420 |
| Molecular Formula | C18H18N6O |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | [(3S)-3-pyrazin-2-ylpiperidin-1-yl]-(6-pyrazol-1-yl-3-pyridinyl)methanone |
| SMILES | O=C(c1ccc(-n2cccn2)nc1)N1CCC[C@H](c2cnccn2)C1 |
| InChI | InChI=1S/C18H18N6O/c25-18(14-4-5-17(21-11-14)24-10-2-6-22-24)23-9-1-3-15(13-23)16-12-19-7-8-20-16/h2,4-8,10-12,15H,1,3,9,13H2/t15-/m0/s1 |
| InChIKey | WFBSDVFGSKBXSC-HNNXBMFYSA-N |
| XLogP | 2.08 |
| TPSA | 76.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |