C15H16N4O — CID 110256969
(3-pyrazin-2-ylpiperidin-1-yl)-pyridin-4-ylmethanone (PubChem CID 110256969) has the molecular formula C15H16N4O and a molecular weight of 268.32 g/mol. Its IUPAC name is (3-pyrazin-2-ylpiperidin-1-yl)-pyridin-4-ylmethanone.
| Compound Name | (3-pyrazin-2-ylpiperidin-1-yl)-pyridin-4-ylmethanone |
|---|---|
| PubChem CID | 110256969 |
| Molecular Formula | C15H16N4O |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | (3-pyrazin-2-ylpiperidin-1-yl)-pyridin-4-ylmethanone |
| SMILES | O=C(c1ccncc1)N1CCCC(c2cnccn2)C1 |
| InChI | InChI=1S/C15H16N4O/c20-15(12-3-5-16-6-4-12)19-9-1-2-13(11-19)14-10-17-7-8-18-14/h3-8,10,13H,1-2,9,11H2 |
| InChIKey | BIMARERIXDWWIX-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 58.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |