C14H15F2N5O — CID 51590865
[1-(difluoromethyl)pyrazol-3-yl]-[(3S)-3-pyrazin-2-ylpiperidin-1-yl]methanone (PubChem CID 51590865) has the molecular formula C14H15F2N5O and a molecular weight of 307.30 g/mol. Its IUPAC name is [1-(difluoromethyl)pyrazol-3-yl]-[(3S)-3-pyrazin-2-ylpiperidin-1-yl]methanone.
| Compound Name | [1-(difluoromethyl)pyrazol-3-yl]-[(3S)-3-pyrazin-2-ylpiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 51590865 |
| Molecular Formula | C14H15F2N5O |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | [1-(difluoromethyl)pyrazol-3-yl]-[(3S)-3-pyrazin-2-ylpiperidin-1-yl]methanone |
| SMILES | O=C(c1ccn(C(F)F)n1)N1CCC[C@H](c2cnccn2)C1 |
| InChI | InChI=1S/C14H15F2N5O/c15-14(16)21-7-3-11(19-21)13(22)20-6-1-2-10(9-20)12-8-17-4-5-18-12/h3-5,7-8,10,14H,1-2,6,9H2/t10-/m0/s1 |
| InChIKey | YVPZAAMITSTMMR-JTQLQIEISA-N |
| XLogP | 2.09 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |