C16H22F2N4O2 — CID 70713232
[1-[1-(difluoromethyl)pyrazole-3-carbonyl]piperidin-4-yl]-piperidin-1-ylmethanone (PubChem CID 70713232) has the molecular formula C16H22F2N4O2 and a molecular weight of 340.37 g/mol. Its IUPAC name is [1-[1-(difluoromethyl)pyrazole-3-carbonyl]piperidin-4-yl]-piperidin-1-ylmethanone.
| Compound Name | [1-[1-(difluoromethyl)pyrazole-3-carbonyl]piperidin-4-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 70713232 |
| Molecular Formula | C16H22F2N4O2 |
| Molecular Weight | 340.37 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | [1-[1-(difluoromethyl)pyrazole-3-carbonyl]piperidin-4-yl]-piperidin-1-ylmethanone |
| SMILES | O=C(c1ccn(C(F)F)n1)N1CCC(C(=O)N2CCCCC2)CC1 |
| InChI | InChI=1S/C16H22F2N4O2/c17-16(18)22-11-6-13(19-22)15(24)21-9-4-12(5-10-21)14(23)20-7-2-1-3-8-20/h6,11-12,16H,1-5,7-10H2 |
| InChIKey | DZEJZKJBEIGOSD-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.37 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |