C16H24F2N4O — CID 46969146
[1-(difluoromethyl)pyrazol-3-yl]-[4-(4-methylpiperidin-1-yl)piperidin-1-yl]methanone (PubChem CID 46969146) has the molecular formula C16H24F2N4O and a molecular weight of 326.39 g/mol. Its IUPAC name is [1-(difluoromethyl)pyrazol-3-yl]-[4-(4-methylpiperidin-1-yl)piperidin-1-yl]methanone.
| Compound Name | [1-(difluoromethyl)pyrazol-3-yl]-[4-(4-methylpiperidin-1-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 46969146 |
| Molecular Formula | C16H24F2N4O |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | [1-(difluoromethyl)pyrazol-3-yl]-[4-(4-methylpiperidin-1-yl)piperidin-1-yl]methanone |
| SMILES | CC1CCN(C2CCN(C(=O)c3ccn(C(F)F)n3)CC2)CC1 |
| InChI | InChI=1S/C16H24F2N4O/c1-12-2-7-20(8-3-12)13-4-9-21(10-5-13)15(23)14-6-11-22(19-14)16(17)18/h6,11-13,16H,2-5,7-10H2,1H3 |
| InChIKey | YAYQGEUZJLBZBC-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |