C15H21N5 — CID 125013738
2-(2-ethylpyrazol-3-yl)-5-[[(3S)-1-methylpyrrolidin-3-yl]methyl]pyrazine (PubChem CID 125013738) has the molecular formula C15H21N5 and a molecular weight of 271.37 g/mol. Its IUPAC name is 2-(2-ethylpyrazol-3-yl)-5-[[(3S)-1-methylpyrrolidin-3-yl]methyl]pyrazine.
| Compound Name | 2-(2-ethylpyrazol-3-yl)-5-[[(3S)-1-methylpyrrolidin-3-yl]methyl]pyrazine |
|---|---|
| PubChem CID | 125013738 |
| Molecular Formula | C15H21N5 |
| Molecular Weight | 271.37 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | 2-(2-ethylpyrazol-3-yl)-5-[[(3S)-1-methylpyrrolidin-3-yl]methyl]pyrazine |
| SMILES | CCn1nccc1-c1cnc(C[C@@H]2CCN(C)C2)cn1 |
| InChI | InChI=1S/C15H21N5/c1-3-20-15(4-6-18-20)14-10-16-13(9-17-14)8-12-5-7-19(2)11-12/h4,6,9-10,12H,3,5,7-8,11H2,1-2H3/t12-/m0/s1 |
| InChIKey | WHEUYIYEKZHEQK-LBPRGKRZSA-N |
| XLogP | 1.85 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.37 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |