C16H17FN4O2 — CID 125015943
1-[(2R)-2-(3-aminopyrazin-2-yl)morpholin-4-yl]-2-(2-fluorophenyl)ethanone (PubChem CID 125015943) has the molecular formula C16H17FN4O2 and a molecular weight of 316.34 g/mol. Its IUPAC name is 1-[(2R)-2-(3-aminopyrazin-2-yl)morpholin-4-yl]-2-(2-fluorophenyl)ethanone.
| Compound Name | 1-[(2R)-2-(3-aminopyrazin-2-yl)morpholin-4-yl]-2-(2-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 125015943 |
| Molecular Formula | C16H17FN4O2 |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 1-[(2R)-2-(3-aminopyrazin-2-yl)morpholin-4-yl]-2-(2-fluorophenyl)ethanone |
| SMILES | Nc1nccnc1[C@H]1CN(C(=O)Cc2ccccc2F)CCO1 |
| InChI | InChI=1S/C16H17FN4O2/c17-12-4-2-1-3-11(12)9-14(22)21-7-8-23-13(10-21)15-16(18)20-6-5-19-15/h1-6,13H,7-10H2,(H2,18,20)/t13-/m1/s1 |
| InChIKey | WXFVMGITFJRWBH-CYBMUJFWSA-N |
| XLogP | 1.34 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |