C13H14N6O2 — CID 125003929
[(2R)-2-(3-aminopyrazin-2-yl)morpholin-4-yl]-pyridazin-4-ylmethanone (PubChem CID 125003929) has the molecular formula C13H14N6O2 and a molecular weight of 286.30 g/mol. Its IUPAC name is [(2R)-2-(3-aminopyrazin-2-yl)morpholin-4-yl]-pyridazin-4-ylmethanone.
| Compound Name | [(2R)-2-(3-aminopyrazin-2-yl)morpholin-4-yl]-pyridazin-4-ylmethanone |
|---|---|
| PubChem CID | 125003929 |
| Molecular Formula | C13H14N6O2 |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | [(2R)-2-(3-aminopyrazin-2-yl)morpholin-4-yl]-pyridazin-4-ylmethanone |
| SMILES | Nc1nccnc1[C@H]1CN(C(=O)c2ccnnc2)CCO1 |
| InChI | InChI=1S/C13H14N6O2/c14-12-11(15-3-4-16-12)10-8-19(5-6-21-10)13(20)9-1-2-17-18-7-9/h1-4,7,10H,5-6,8H2,(H2,14,16)/t10-/m1/s1 |
| InChIKey | SUYPLPXSATXQNT-SNVBAGLBSA-N |
| XLogP | 0.06 |
| TPSA | 107.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |