C15H19ClN6O2 — CID 124990646
[(2R)-2-(3-aminopyrazin-2-yl)morpholin-4-yl]-(4-chloro-1-propylpyrazol-3-yl)methanone (PubChem CID 124990646) has the molecular formula C15H19ClN6O2 and a molecular weight of 350.81 g/mol. Its IUPAC name is [(2R)-2-(3-aminopyrazin-2-yl)morpholin-4-yl]-(4-chloro-1-propylpyrazol-3-yl)methanone.
| Compound Name | [(2R)-2-(3-aminopyrazin-2-yl)morpholin-4-yl]-(4-chloro-1-propylpyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 124990646 |
| Molecular Formula | C15H19ClN6O2 |
| Molecular Weight | 350.81 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | [(2R)-2-(3-aminopyrazin-2-yl)morpholin-4-yl]-(4-chloro-1-propylpyrazol-3-yl)methanone |
| SMILES | CCCn1cc(Cl)c(C(=O)N2CCO[C@@H](c3nccnc3N)C2)n1 |
| InChI | InChI=1S/C15H19ClN6O2/c1-2-5-22-8-10(16)12(20-22)15(23)21-6-7-24-11(9-21)13-14(17)19-4-3-18-13/h3-4,8,11H,2,5-7,9H2,1H3,(H2,17,19)/t11-/m1/s1 |
| InChIKey | PDFNPWACYPZFLR-LLVKDONJSA-N |
| XLogP | 1.53 |
| TPSA | 99.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.81 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |