C13H16N4O2 — CID 125019638
(1-methylpyrrol-2-yl)-[(3S)-3-(1H-pyrazol-5-yl)morpholin-4-yl]methanone (PubChem CID 125019638) has the molecular formula C13H16N4O2 and a molecular weight of 260.30 g/mol. Its IUPAC name is (1-methylpyrrol-2-yl)-[(3S)-3-(1H-pyrazol-5-yl)morpholin-4-yl]methanone.
| Compound Name | (1-methylpyrrol-2-yl)-[(3S)-3-(1H-pyrazol-5-yl)morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 125019638 |
| Molecular Formula | C13H16N4O2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | (1-methylpyrrol-2-yl)-[(3S)-3-(1H-pyrazol-5-yl)morpholin-4-yl]methanone |
| SMILES | Cn1cccc1C(=O)N1CCOC[C@@H]1c1ccn[nH]1 |
| InChI | InChI=1S/C13H16N4O2/c1-16-6-2-3-11(16)13(18)17-7-8-19-9-12(17)10-4-5-14-15-10/h2-6,12H,7-9H2,1H3,(H,14,15)/t12-/m1/s1 |
| InChIKey | XXKSJZYSNLQEPS-GFCCVEGCSA-N |
| XLogP | 0.96 |
| TPSA | 63.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |