C12H15N5O2S — CID 124943736
(4-ethylthiadiazol-5-yl)-[(3S)-3-(1H-pyrazol-5-yl)morpholin-4-yl]methanone (PubChem CID 124943736) has the molecular formula C12H15N5O2S and a molecular weight of 293.35 g/mol. Its IUPAC name is (4-ethylthiadiazol-5-yl)-[(3S)-3-(1H-pyrazol-5-yl)morpholin-4-yl]methanone.
| Compound Name | (4-ethylthiadiazol-5-yl)-[(3S)-3-(1H-pyrazol-5-yl)morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 124943736 |
| Molecular Formula | C12H15N5O2S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | (4-ethylthiadiazol-5-yl)-[(3S)-3-(1H-pyrazol-5-yl)morpholin-4-yl]methanone |
| SMILES | CCc1nnsc1C(=O)N1CCOC[C@@H]1c1ccn[nH]1 |
| InChI | InChI=1S/C12H15N5O2S/c1-2-8-11(20-16-15-8)12(18)17-5-6-19-7-10(17)9-3-4-13-14-9/h3-4,10H,2,5-7H2,1H3,(H,13,14)/t10-/m1/s1 |
| InChIKey | BETQPZZQKQPYPU-SNVBAGLBSA-N |
| XLogP | 1.04 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |