C11H15N3O4 — CID 125026828
4-oxo-4-[(3S)-3-(1H-pyrazol-5-yl)morpholin-4-yl]butanoic acid (PubChem CID 125026828) has the molecular formula C11H15N3O4 and a molecular weight of 253.26 g/mol. Its IUPAC name is 4-oxo-4-[(3S)-3-(1H-pyrazol-5-yl)morpholin-4-yl]butanoic acid.
| Compound Name | 4-oxo-4-[(3S)-3-(1H-pyrazol-5-yl)morpholin-4-yl]butanoic acid |
|---|---|
| PubChem CID | 125026828 |
| Molecular Formula | C11H15N3O4 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 4-oxo-4-[(3S)-3-(1H-pyrazol-5-yl)morpholin-4-yl]butanoic acid |
| SMILES | O=C(O)CCC(=O)N1CCOC[C@@H]1c1ccn[nH]1 |
| InChI | InChI=1S/C11H15N3O4/c15-10(1-2-11(16)17)14-5-6-18-7-9(14)8-3-4-12-13-8/h3-4,9H,1-2,5-7H2,(H,12,13)(H,16,17)/t9-/m1/s1 |
| InChIKey | ZWJFZKBCTGBXEU-SECBINFHSA-N |
| XLogP | 0.17 |
| TPSA | 95.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |