C20H25N3O2 — CID 125019657
2-[2-methyl-6-[(2S)-1-propan-2-ylpiperidin-2-yl]pyrimidin-4-yl]benzoic acid (PubChem CID 125019657) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is 2-[2-methyl-6-[(2S)-1-propan-2-ylpiperidin-2-yl]pyrimidin-4-yl]benzoic acid.
| Compound Name | 2-[2-methyl-6-[(2S)-1-propan-2-ylpiperidin-2-yl]pyrimidin-4-yl]benzoic acid |
|---|---|
| PubChem CID | 125019657 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | 2-[2-methyl-6-[(2S)-1-propan-2-ylpiperidin-2-yl]pyrimidin-4-yl]benzoic acid |
| SMILES | Cc1nc(-c2ccccc2C(=O)O)cc([C@@H]2CCCCN2C(C)C)n1 |
| InChI | InChI=1S/C20H25N3O2/c1-13(2)23-11-7-6-10-19(23)18-12-17(21-14(3)22-18)15-8-4-5-9-16(15)20(24)25/h4-5,8-9,12-13,19H,6-7,10-11H2,1-3H3,(H,24,25)/t19-/m0/s1 |
| InChIKey | XXNKJZQZECMLMX-IBGZPJMESA-N |
| XLogP | 4.09 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |