About (2S)-N,N-dimethyl-2-[2-[6-(methylamino)-2-pyridinyl]ethyl]piperidine-1-sulfonamide
(2S)-N,N-dimethyl-2-[2-[6-(methylamino)-2-pyridinyl]ethyl]piperidine-1-sulfonamide (PubChem CID 125021160) has the molecular formula C15H26N4O2S
and a molecular weight of 326.47 g/mol. Its IUPAC name is (2S)-N,N-dimethyl-2-[2-[6-(methylamino)-2-pyridinyl]ethyl]piperidine-1-sulfonamide.
Molecular Properties
| Compound Name | (2S)-N,N-dimethyl-2-[2-[6-(methylamino)-2-pyridinyl]ethyl]piperidine-1-sulfonamide |
| PubChem CID | 125021160 |
| Molecular Formula | C15H26N4O2S |
| Molecular Weight | 326.47 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | (2S)-N,N-dimethyl-2-[2-[6-(methylamino)-2-pyridinyl]ethyl]piperidine-1-sulfonamide |
| SMILES | CNc1cccc(CC[C@@H]2CCCCN2S(=O)(=O)N(C)C)n1 |
| InChI | InChI=1S/C15H26N4O2S/c1-16-15-9-6-7-13(17-15)10-11-14-8-4-5-12-19(14)22(20,21)18(2)3/h6-7,9,14H,4-5,8,10-12H2,1-3H3,(H,16,17)/t14-/m0/s1 |
| InChIKey | YHVJRGKMXRWJAJ-AWEZNQCLSA-N |
| XLogP | 1.72 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.47 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-N,N-dimethyl-2-[2-[6-(methylamino)-2-pyridinyl]ethyl]piperidine-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N,N-dimethyl-2-[2-[6-(methylamino)-2-pyridinyl]ethyl]piperidine-1-sulfonamide?
The IUPAC name of (2S)-N,N-dimethyl-2-[2-[6-(methylamino)-2-pyridinyl]ethyl]piperidine-1-sulfonamide (CID 125021160) is (2S)-N,N-dimethyl-2-[2-[6-(methylamino)-2-pyridinyl]ethyl]piperidine-1-sulfonamide.
What is the SMILES notation for (2S)-N,N-dimethyl-2-[2-[6-(methylamino)-2-pyridinyl]ethyl]piperidine-1-sulfonamide?
The canonical SMILES for (2S)-N,N-dimethyl-2-[2-[6-(methylamino)-2-pyridinyl]ethyl]piperidine-1-sulfonamide is CNc1cccc(CC[C@@H]2CCCCN2S(=O)(=O)N(C)C)n1.
What is the InChIKey of (2S)-N,N-dimethyl-2-[2-[6-(methylamino)-2-pyridinyl]ethyl]piperidine-1-sulfonamide?
The InChIKey is YHVJRGKMXRWJAJ-AWEZNQCLSA-N. The full InChI is InChI=1S/C15H26N4O2S/c1-16-15-9-6-7-13(17-15)10-11-14-8-4-5-12-19(14)22(20,21)18(2)3/h6-7,9,14H,4-5,8,10-12H2,1-3H3,(H,16,17)/t14-/m0/s1.
What are the key properties of (2S)-N,N-dimethyl-2-[2-[6-(methylamino)-2-pyridinyl]ethyl]piperidine-1-sulfonamide?
(2S)-N,N-dimethyl-2-[2-[6-(methylamino)-2-pyridinyl]ethyl]piperidine-1-sulfonamide has a molecular weight of 326.47 g/mol, XLogP of 1.72, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N,N-dimethyl-2-[2-[6-(methylamino)-2-pyridinyl]ethyl]piperidine-1-sulfonamide is sourced from PubChem (CID 125021160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).