C25H27N3O — CID 125027034
[(3S)-3-[2-(dimethylamino)-4-pyridinyl]piperidin-1-yl]-(2-phenylphenyl)methanone (PubChem CID 125027034) has the molecular formula C25H27N3O and a molecular weight of 385.51 g/mol. Its IUPAC name is [(3S)-3-[2-(dimethylamino)-4-pyridinyl]piperidin-1-yl]-(2-phenylphenyl)methanone.
| Compound Name | [(3S)-3-[2-(dimethylamino)-4-pyridinyl]piperidin-1-yl]-(2-phenylphenyl)methanone |
|---|---|
| PubChem CID | 125027034 |
| Molecular Formula | C25H27N3O |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | [(3S)-3-[2-(dimethylamino)-4-pyridinyl]piperidin-1-yl]-(2-phenylphenyl)methanone |
| SMILES | CN(C)c1cc([C@@H]2CCCN(C(=O)c3ccccc3-c3ccccc3)C2)ccn1 |
| InChI | InChI=1S/C25H27N3O/c1-27(2)24-17-20(14-15-26-24)21-11-8-16-28(18-21)25(29)23-13-7-6-12-22(23)19-9-4-3-5-10-19/h3-7,9-10,12-15,17,21H,8,11,16,18H2,1-2H3/t21-/m1/s1 |
| InChIKey | ZXZKORMMPSFTAE-OAQYLSRUSA-N |
| XLogP | 4.83 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |