C19H22ClN3O — CID 125474114
[(3R)-3-(2-chlorophenyl)piperidin-1-yl]-[2-(dimethylamino)-4-pyridinyl]methanone (PubChem CID 125474114) has the molecular formula C19H22ClN3O and a molecular weight of 343.86 g/mol. Its IUPAC name is [(3R)-3-(2-chlorophenyl)piperidin-1-yl]-[2-(dimethylamino)-4-pyridinyl]methanone.
| Compound Name | [(3R)-3-(2-chlorophenyl)piperidin-1-yl]-[2-(dimethylamino)-4-pyridinyl]methanone |
|---|---|
| PubChem CID | 125474114 |
| Molecular Formula | C19H22ClN3O |
| Molecular Weight | 343.86 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | [(3R)-3-(2-chlorophenyl)piperidin-1-yl]-[2-(dimethylamino)-4-pyridinyl]methanone |
| SMILES | CN(C)c1cc(C(=O)N2CCC[C@H](c3ccccc3Cl)C2)ccn1 |
| InChI | InChI=1S/C19H22ClN3O/c1-22(2)18-12-14(9-10-21-18)19(24)23-11-5-6-15(13-23)16-7-3-4-8-17(16)20/h3-4,7-10,12,15H,5-6,11,13H2,1-2H3/t15-/m0/s1 |
| InChIKey | KSZYNQSHUSMPLO-HNNXBMFYSA-N |
| XLogP | 3.82 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.86 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |