C25H27ClN2 — CID 125027075
5-[(4-chlorophenyl)methyl]-2-[(3R)-1-(2-phenylethyl)piperidin-3-yl]pyridine (PubChem CID 125027075) has the molecular formula C25H27ClN2 and a molecular weight of 390.96 g/mol. Its IUPAC name is 5-[(4-chlorophenyl)methyl]-2-[(3R)-1-(2-phenylethyl)piperidin-3-yl]pyridine.
| Compound Name | 5-[(4-chlorophenyl)methyl]-2-[(3R)-1-(2-phenylethyl)piperidin-3-yl]pyridine |
|---|---|
| PubChem CID | 125027075 |
| Molecular Formula | C25H27ClN2 |
| Molecular Weight | 390.96 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 5-[(4-chlorophenyl)methyl]-2-[(3R)-1-(2-phenylethyl)piperidin-3-yl]pyridine |
| SMILES | Clc1ccc(Cc2ccc([C@@H]3CCCN(CCc4ccccc4)C3)nc2)cc1 |
| InChI | InChI=1S/C25H27ClN2/c26-24-11-8-21(9-12-24)17-22-10-13-25(27-18-22)23-7-4-15-28(19-23)16-14-20-5-2-1-3-6-20/h1-3,5-6,8-13,18,23H,4,7,14-17,19H2/t23-/m1/s1 |
| InChIKey | ZYHKQGOSLNQTTQ-HSZRJFAPSA-N |
| XLogP | 5.75 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.96 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |