C19H28F2O — CID 125027832
(5S,8S,9R,10R,13S,14S)-6,6-difluoro-10,13-dimethyl-2,3,4,5,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one (PubChem CID 125027832) has the molecular formula C19H28F2O and a molecular weight of 310.43 g/mol. Its IUPAC name is (5S,8S,9R,10R,13S,14S)-6,6-difluoro-10,13-dimethyl-2,3,4,5,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (5S,8S,9R,10R,13S,14S)-6,6-difluoro-10,13-dimethyl-2,3,4,5,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 125027832 |
| Molecular Formula | C19H28F2O |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | (5S,8S,9R,10R,13S,14S)-6,6-difluoro-10,13-dimethyl-2,3,4,5,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12CCCC[C@@H]1C(F)(F)C[C@H]1[C@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C19H28F2O/c1-17-9-4-3-5-15(17)19(20,21)11-12-13-6-7-16(22)18(13,2)10-8-14(12)17/h12-15H,3-11H2,1-2H3/t12-,13+,14-,15+,17-,18+/m1/s1 |
| InChIKey | FZODUPVRMSULRC-GKJLGGESSA-N |
| XLogP | 5.23 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |