C19H28O3 — CID 125028212
(5R,8S,9R,10S,13S,14S,17R)-17-hydroxy-10,13-dimethyl-3,4,5,6,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-2,7-dione (PubChem CID 125028212) has the molecular formula C19H28O3 and a molecular weight of 304.43 g/mol. Its IUPAC name is (5R,8S,9R,10S,13S,14S,17R)-17-hydroxy-10,13-dimethyl-3,4,5,6,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-2,7-dione.
| Compound Name | (5R,8S,9R,10S,13S,14S,17R)-17-hydroxy-10,13-dimethyl-3,4,5,6,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-2,7-dione |
|---|---|
| PubChem CID | 125028212 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | (5R,8S,9R,10S,13S,14S,17R)-17-hydroxy-10,13-dimethyl-3,4,5,6,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-2,7-dione |
| SMILES | C[C@]12CC(=O)CC[C@@H]1CC(=O)[C@H]1[C@H]2CC[C@]2(C)[C@H](O)CC[C@@H]12 |
| InChI | InChI=1S/C19H28O3/c1-18-8-7-14-17(13(18)5-6-16(18)22)15(21)9-11-3-4-12(20)10-19(11,14)2/h11,13-14,16-17,22H,3-10H2,1-2H3/t11-,13+,14-,16-,17-,18+,19+/m1/s1 |
| InChIKey | PRCPAPQMRSUFRB-GBSJXCTESA-N |
| XLogP | 3.14 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |