C21H21NO10 — CID 125029299
(E)-1-[2-hydroxy-6-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-3-(4-nitrophenyl)prop-2-en-1-one (PubChem CID 125029299) has the molecular formula C21H21NO10 and a molecular weight of 447.40 g/mol. Its IUPAC name is (E)-1-[2-hydroxy-6-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-3-(4-nitrophenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[2-hydroxy-6-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-3-(4-nitrophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 125029299 |
| Molecular Formula | C21H21NO10 |
| Molecular Weight | 447.40 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | (E)-1-[2-hydroxy-6-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-3-(4-nitrophenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc([N+](=O)[O-])cc1)c1c(O)cccc1O[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C21H21NO10/c23-10-16-18(26)19(27)20(28)21(32-16)31-15-3-1-2-13(24)17(15)14(25)9-6-11-4-7-12(8-5-11)22(29)30/h1-9,16,18-21,23-24,26-28H,10H2/b9-6+/t16-,18+,19+,20-,21+/m1/s1 |
| InChIKey | AZLVLUVDAXJKAC-UPNYOHLSSA-N |
| XLogP | 0.38 |
| TPSA | 179.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.40 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|