C28H28O9 — CID 11799784
(E)-1-[2-hydroxy-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-3-(4-phenylmethoxyphenyl)prop-2-en-1-one (PubChem CID 11799784) has the molecular formula C28H28O9 and a molecular weight of 508.52 g/mol. Its IUPAC name is (E)-1-[2-hydroxy-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-3-(4-phenylmethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[2-hydroxy-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-3-(4-phenylmethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 11799784 |
| Molecular Formula | C28H28O9 |
| Molecular Weight | 508.52 g/mol |
| Exact Mass | 508.17 |
| IUPAC Name | (E)-1-[2-hydroxy-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-3-(4-phenylmethoxyphenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(OCc2ccccc2)cc1)c1c(O)cccc1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C28H28O9/c29-15-23-25(32)26(33)27(34)28(37-23)36-22-8-4-7-20(30)24(22)21(31)14-11-17-9-12-19(13-10-17)35-16-18-5-2-1-3-6-18/h1-14,23,25-30,32-34H,15-16H2/b14-11+/t23-,25-,26+,27-,28-/m1/s1 |
| InChIKey | YYHFUFXQYFSOMB-BFMYGVAXSA-N |
| XLogP | 2.05 |
| TPSA | 145.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.52 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|