C23H31BrO6 — CID 125029756
[2-[(4S,5R,8S,9S,10R,13R,14R,17S)-4-bromo-17-hydroxy-10,13-dimethyl-3,11-dioxo-1,2,4,5,6,7,8,9,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate (PubChem CID 125029756) has the molecular formula C23H31BrO6 and a molecular weight of 483.40 g/mol. Its IUPAC name is [2-[(4S,5R,8S,9S,10R,13R,14R,17S)-4-bromo-17-hydroxy-10,13-dimethyl-3,11-dioxo-1,2,4,5,6,7,8,9,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate.
| Compound Name | [2-[(4S,5R,8S,9S,10R,13R,14R,17S)-4-bromo-17-hydroxy-10,13-dimethyl-3,11-dioxo-1,2,4,5,6,7,8,9,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 125029756 |
| Molecular Formula | C23H31BrO6 |
| Molecular Weight | 483.40 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | [2-[(4S,5R,8S,9S,10R,13R,14R,17S)-4-bromo-17-hydroxy-10,13-dimethyl-3,11-dioxo-1,2,4,5,6,7,8,9,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
| SMILES | CC(=O)OCC(=O)[C@]1(O)CC[C@@H]2[C@@H]3CC[C@H]4[C@H](Br)C(=O)CC[C@]4(C)[C@H]3C(=O)C[C@]21C |
| InChI | InChI=1S/C23H31BrO6/c1-12(25)30-11-18(28)23(29)9-6-14-13-4-5-15-20(24)16(26)7-8-21(15,2)19(13)17(27)10-22(14,23)3/h13-15,19-20,29H,4-11H2,1-3H3/t13-,14+,15-,19+,20-,21-,22+,23+/m0/s1 |
| InChIKey | SUYDMLDXAOBPDP-FSQHRTMISA-N |
| XLogP | 3.01 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|